C19H25ClN2O — CID 108896066
1-(1-adamantyl)-3-(2-chloro-4,6-dimethylphenyl)urea (PubChem CID 108896066) has the molecular formula C19H25ClN2O and a molecular weight of 332.88 g/mol. Its IUPAC name is 1-(1-adamantyl)-3-(2-chloro-4,6-dimethylphenyl)urea.
| Compound Name | 1-(1-adamantyl)-3-(2-chloro-4,6-dimethylphenyl)urea |
|---|---|
| PubChem CID | 108896066 |
| Molecular Formula | C19H25ClN2O |
| Molecular Weight | 332.88 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | 1-(1-adamantyl)-3-(2-chloro-4,6-dimethylphenyl)urea |
| SMILES | Cc1cc(C)c(NC(=O)NC23CC4CC(CC(C4)C2)C3)c(Cl)c1 |
| InChI | InChI=1S/C19H25ClN2O/c1-11-3-12(2)17(16(20)4-11)21-18(23)22-19-8-13-5-14(9-19)7-15(6-13)10-19/h3-4,13-15H,5-10H2,1-2H3,(H2,21,22,23) |
| InChIKey | BQPYLZCWSMULCG-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.88 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |