C17H22N2O3 — CID 108895563
1-(1-adamantyl)-3-(3,5-dihydroxyphenyl)urea (PubChem CID 108895563) has the molecular formula C17H22N2O3 and a molecular weight of 302.37 g/mol. Its IUPAC name is 1-(1-adamantyl)-3-(3,5-dihydroxyphenyl)urea.
| Compound Name | 1-(1-adamantyl)-3-(3,5-dihydroxyphenyl)urea |
|---|---|
| PubChem CID | 108895563 |
| Molecular Formula | C17H22N2O3 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | 1-(1-adamantyl)-3-(3,5-dihydroxyphenyl)urea |
| SMILES | O=C(Nc1cc(O)cc(O)c1)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C17H22N2O3/c20-14-4-13(5-15(21)6-14)18-16(22)19-17-7-10-1-11(8-17)3-12(2-10)9-17/h4-6,10-12,20-21H,1-3,7-9H2,(H2,18,19,22) |
| InChIKey | DHEAQJHUDRGTMU-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |