C20H26N2O2 — CID 71595179
1-(1-adamantyl)-3-[4-(2-oxopropyl)phenyl]urea (PubChem CID 71595179) has the molecular formula C20H26N2O2 and a molecular weight of 326.44 g/mol. Its IUPAC name is 1-(1-adamantyl)-3-[4-(2-oxopropyl)phenyl]urea.
| Compound Name | 1-(1-adamantyl)-3-[4-(2-oxopropyl)phenyl]urea |
|---|---|
| PubChem CID | 71595179 |
| Molecular Formula | C20H26N2O2 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.20 |
| IUPAC Name | 1-(1-adamantyl)-3-[4-(2-oxopropyl)phenyl]urea |
| SMILES | CC(=O)Cc1ccc(NC(=O)NC23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C20H26N2O2/c1-13(23)6-14-2-4-18(5-3-14)21-19(24)22-20-10-15-7-16(11-20)9-17(8-15)12-20/h2-5,15-17H,6-12H2,1H3,(H2,21,22,24) |
| InChIKey | NPSMBAIPFVDSCM-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |