C20H26N2O3 — CID 11595336
3-[4-(1-adamantylcarbamoylamino)phenyl]propanoic acid (PubChem CID 11595336) has the molecular formula C20H26N2O3 and a molecular weight of 342.44 g/mol. Its IUPAC name is 3-[4-(1-adamantylcarbamoylamino)phenyl]propanoic acid.
| Compound Name | 3-[4-(1-adamantylcarbamoylamino)phenyl]propanoic acid |
|---|---|
| PubChem CID | 11595336 |
| Molecular Formula | C20H26N2O3 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | 3-[4-(1-adamantylcarbamoylamino)phenyl]propanoic acid |
| SMILES | O=C(O)CCc1ccc(NC(=O)NC23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C20H26N2O3/c23-18(24)6-3-13-1-4-17(5-2-13)21-19(25)22-20-10-14-7-15(11-20)9-16(8-14)12-20/h1-2,4-5,14-16H,3,6-12H2,(H,23,24)(H2,21,22,25) |
| InChIKey | XHKMRJQBQASRKS-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |