C22H30N2O2 — CID 108502507
N'-(1-adamantyl)-N-(4-butylphenyl)oxamide (PubChem CID 108502507) has the molecular formula C22H30N2O2 and a molecular weight of 354.49 g/mol. Its IUPAC name is N'-(1-adamantyl)-N-(4-butylphenyl)oxamide.
| Compound Name | N'-(1-adamantyl)-N-(4-butylphenyl)oxamide |
|---|---|
| PubChem CID | 108502507 |
| Molecular Formula | C22H30N2O2 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.23 |
| IUPAC Name | N'-(1-adamantyl)-N-(4-butylphenyl)oxamide |
| SMILES | CCCCc1ccc(NC(=O)C(=O)NC23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C22H30N2O2/c1-2-3-4-15-5-7-19(8-6-15)23-20(25)21(26)24-22-12-16-9-17(13-22)11-18(10-16)14-22/h5-8,16-18H,2-4,9-14H2,1H3,(H,23,25)(H,24,26) |
| InChIKey | KKIHOIRXIFNUDZ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|