C20H27N3O2 — CID 108527915
N'-(1-adamantyl)-N-[4-(dimethylamino)phenyl]oxamide (PubChem CID 108527915) has the molecular formula C20H27N3O2 and a molecular weight of 341.45 g/mol. Its IUPAC name is N'-(1-adamantyl)-N-[4-(dimethylamino)phenyl]oxamide.
| Compound Name | N'-(1-adamantyl)-N-[4-(dimethylamino)phenyl]oxamide |
|---|---|
| PubChem CID | 108527915 |
| Molecular Formula | C20H27N3O2 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.21 |
| IUPAC Name | N'-(1-adamantyl)-N-[4-(dimethylamino)phenyl]oxamide |
| SMILES | CN(C)c1ccc(NC(=O)C(=O)NC23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C20H27N3O2/c1-23(2)17-5-3-16(4-6-17)21-18(24)19(25)22-20-10-13-7-14(11-20)9-15(8-13)12-20/h3-6,13-15H,7-12H2,1-2H3,(H,21,24)(H,22,25) |
| InChIKey | NXWKRUKHIIVUHM-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|