C19H24N2O2 — CID 108520987
N-(1-adamantyl)-N'-methyl-N'-phenyloxamide (PubChem CID 108520987) has the molecular formula C19H24N2O2 and a molecular weight of 312.41 g/mol. Its IUPAC name is N-(1-adamantyl)-N'-methyl-N'-phenyloxamide.
| Compound Name | N-(1-adamantyl)-N'-methyl-N'-phenyloxamide |
|---|---|
| PubChem CID | 108520987 |
| Molecular Formula | C19H24N2O2 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | N-(1-adamantyl)-N'-methyl-N'-phenyloxamide |
| SMILES | CN(C(=O)C(=O)NC12CC3CC(CC(C3)C1)C2)c1ccccc1 |
| InChI | InChI=1S/C19H24N2O2/c1-21(16-5-3-2-4-6-16)18(23)17(22)20-19-10-13-7-14(11-19)9-15(8-13)12-19/h2-6,13-15H,7-12H2,1H3,(H,20,22) |
| InChIKey | LCMXAZCXMIODLV-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|