C25H29NO — CID 10737199
N-(1-adamantyl)-2,2-diphenylpropanamide (PubChem CID 10737199) has the molecular formula C25H29NO and a molecular weight of 359.51 g/mol. Its IUPAC name is N-(1-adamantyl)-2,2-diphenylpropanamide.
| Compound Name | N-(1-adamantyl)-2,2-diphenylpropanamide |
|---|---|
| PubChem CID | 10737199 |
| Molecular Formula | C25H29NO |
| Molecular Weight | 359.51 g/mol |
| Exact Mass | 359.22 |
| IUPAC Name | N-(1-adamantyl)-2,2-diphenylpropanamide |
| SMILES | CC(C(=O)NC12CC3CC(CC(C3)C1)C2)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H29NO/c1-24(21-8-4-2-5-9-21,22-10-6-3-7-11-22)23(27)26-25-15-18-12-19(16-25)14-20(13-18)17-25/h2-11,18-20H,12-17H2,1H3,(H,26,27) |
| InChIKey | ZZTPOPSIKVJAOB-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.51 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |