C18H24O — CID 7116226
(1R)-1-(1-adamantyl)-1-phenylethanol (PubChem CID 7116226) has the molecular formula C18H24O and a molecular weight of 256.39 g/mol. Its IUPAC name is (1R)-1-(1-adamantyl)-1-phenylethanol.
| Compound Name | (1R)-1-(1-adamantyl)-1-phenylethanol |
|---|---|
| PubChem CID | 7116226 |
| Molecular Formula | C18H24O |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.18 |
| IUPAC Name | (1R)-1-(1-adamantyl)-1-phenylethanol |
| SMILES | C[C@](O)(c1ccccc1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C18H24O/c1-17(19,16-5-3-2-4-6-16)18-10-13-7-14(11-18)9-15(8-13)12-18/h2-6,13-15,19H,7-12H2,1H3/t13?,14?,15?,17-,18?/m0/s1 |
| InChIKey | CIMLZOAGOCVTHD-UUMMVJRDSA-N |
| XLogP | 4.11 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |