About bis(1-adamantylimino)molybdenum(2+);bis(2-methanidylpropan-2-ylbenzene)
bis(1-adamantylimino)molybdenum(2+);bis(2-methanidylpropan-2-ylbenzene) (PubChem CID 153439114) has the molecular formula C40H56MoN2
and a molecular weight of 660.84 g/mol. Its IUPAC name is bis(1-adamantylimino)molybdenum(2+);bis(2-methanidylpropan-2-ylbenzene).
Molecular Properties
| Compound Name | bis(1-adamantylimino)molybdenum(2+);bis(2-methanidylpropan-2-ylbenzene) |
| PubChem CID | 153439114 |
| Molecular Formula | C40H56MoN2 |
| Molecular Weight | 660.84 g/mol |
| Exact Mass | 662.35 |
| IUPAC Name | bis(1-adamantylimino)molybdenum(2+);bis(2-methanidylpropan-2-ylbenzene) |
| SMILES | C1C2CC3CC1CC(N=[Mo+2]=NC14CC5CC(CC(C5)C1)C4)(C2)C3.[CH2-]C(C)(C)c1ccccc1.[CH2-]C(C)(C)c1ccccc1 |
| InChI | InChI=1S/2C10H15N.2C10H13.Mo/c2*11-10-4-7-1-8(5-10)3-9(2-7)6-10;2*1-10(2,3)9-7-5-4-6-8-9;/h2*7-9H,1-6H2;2*4-8H,1H2,2-3H3;/q;;2*-1;+2 |
| InChIKey | MZEUJMFBHGAXEU-UHFFFAOYSA-N |
| XLogP | 10.97 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 660.84 |
| LogP ≤ 5 | 10.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze bis(1-adamantylimino)molybdenum(2+);bis(2-methanidylpropan-2-ylbenzene) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(1-adamantylimino)molybdenum(2+);bis(2-methanidylpropan-2-ylbenzene)?
The IUPAC name of bis(1-adamantylimino)molybdenum(2+);bis(2-methanidylpropan-2-ylbenzene) (CID 153439114) is bis(1-adamantylimino)molybdenum(2+);bis(2-methanidylpropan-2-ylbenzene).
What is the SMILES notation for bis(1-adamantylimino)molybdenum(2+);bis(2-methanidylpropan-2-ylbenzene)?
The canonical SMILES for bis(1-adamantylimino)molybdenum(2+);bis(2-methanidylpropan-2-ylbenzene) is C1C2CC3CC1CC(N=[Mo+2]=NC14CC5CC(CC(C5)C1)C4)(C2)C3.[CH2-]C(C)(C)c1ccccc1.[CH2-]C(C)(C)c1ccccc1.
What is the InChIKey of bis(1-adamantylimino)molybdenum(2+);bis(2-methanidylpropan-2-ylbenzene)?
The InChIKey is MZEUJMFBHGAXEU-UHFFFAOYSA-N. The full InChI is InChI=1S/2C10H15N.2C10H13.Mo/c2*11-10-4-7-1-8(5-10)3-9(2-7)6-10;2*1-10(2,3)9-7-5-4-6-8-9;/h2*7-9H,1-6H2;2*4-8H,1H2,2-3H3;/q;;2*-1;+2.
What are the key properties of bis(1-adamantylimino)molybdenum(2+);bis(2-methanidylpropan-2-ylbenzene)?
bis(1-adamantylimino)molybdenum(2+);bis(2-methanidylpropan-2-ylbenzene) has a molecular weight of 660.84 g/mol, XLogP of 10.97, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis(1-adamantylimino)molybdenum(2+);bis(2-methanidylpropan-2-ylbenzene) is sourced from PubChem (CID 153439114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).