C20H31MoNO2 — CID 134940199
1-adamantylimino-(2-methyl-2-phenylpropylidene)molybdenum;dihydrate (PubChem CID 134940199) has the molecular formula C20H31MoNO2 and a molecular weight of 413.41 g/mol. Its IUPAC name is 1-adamantylimino-(2-methyl-2-phenylpropylidene)molybdenum;dihydrate.
| Compound Name | 1-adamantylimino-(2-methyl-2-phenylpropylidene)molybdenum;dihydrate |
|---|---|
| PubChem CID | 134940199 |
| Molecular Formula | C20H31MoNO2 |
| Molecular Weight | 413.41 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | 1-adamantylimino-(2-methyl-2-phenylpropylidene)molybdenum;dihydrate |
| SMILES | CC(C)(C=[Mo]=NC12CC3CC(CC(C3)C1)C2)c1ccccc1.O.O |
| InChI | InChI=1S/C10H15N.C10H12.Mo.2H2O/c11-10-4-7-1-8(5-10)3-9(2-7)6-10;1-10(2,3)9-7-5-4-6-8-9;;;/h7-9H,1-6H2;1,4-8H,2-3H3;;2*1H2 |
| InChIKey | SIVFOWRPZLZGRV-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 75.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.41 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |