C26H29F12MoNO2 — CID 10996131
(2,6-dimethylphenyl)imino-(2-methyl-2-phenylpropylidene)molybdenum;bis(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-ol) (PubChem CID 10996131) has the molecular formula C26H29F12MoNO2 and a molecular weight of 711.44 g/mol. Its IUPAC name is (2,6-dimethylphenyl)imino-(2-methyl-2-phenylpropylidene)molybdenum;bis(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-ol).
| Compound Name | (2,6-dimethylphenyl)imino-(2-methyl-2-phenylpropylidene)molybdenum;bis(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-ol) |
|---|---|
| PubChem CID | 10996131 |
| Molecular Formula | C26H29F12MoNO2 |
| Molecular Weight | 711.44 g/mol |
| Exact Mass | 713.11 |
| IUPAC Name | (2,6-dimethylphenyl)imino-(2-methyl-2-phenylpropylidene)molybdenum;bis(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-ol) |
| SMILES | CC(O)(C(F)(F)F)C(F)(F)F.CC(O)(C(F)(F)F)C(F)(F)F.Cc1cccc(C)c1N=[Mo]=CC(C)(C)c1ccccc1 |
| InChI | InChI=1S/C10H12.C8H9N.2C4H4F6O.Mo/c1-10(2,3)9-7-5-4-6-8-9;1-6-4-3-5-7(2)8(6)9;2*1-2(11,3(5,6)7)4(8,9)10;/h1,4-8H,2-3H3;3-5H,1-2H3;2*11H,1H3; |
| InChIKey | VMDRKZKCXUMWBR-UHFFFAOYSA-N |
| XLogP | 8.71 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.44 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |