C22H31NO — CID 137482576
N-(4-tert-butyl-1-adamantyl)-2-phenylacetamide (PubChem CID 137482576) has the molecular formula C22H31NO and a molecular weight of 325.50 g/mol. Its IUPAC name is N-(4-tert-butyl-1-adamantyl)-2-phenylacetamide.
| Compound Name | N-(4-tert-butyl-1-adamantyl)-2-phenylacetamide |
|---|---|
| PubChem CID | 137482576 |
| Molecular Formula | C22H31NO |
| Molecular Weight | 325.50 g/mol |
| Exact Mass | 325.24 |
| IUPAC Name | N-(4-tert-butyl-1-adamantyl)-2-phenylacetamide |
| SMILES | CC(C)(C)C1C2CC3CC1CC(NC(=O)Cc1ccccc1)(C3)C2 |
| InChI | InChI=1S/C22H31NO/c1-21(2,3)20-17-9-16-10-18(20)14-22(12-16,13-17)23-19(24)11-15-7-5-4-6-8-15/h4-8,16-18,20H,9-14H2,1-3H3,(H,23,24) |
| InChIKey | JEMSYEVLHPRUDG-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.50 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |