C18H25ClN2O2 — CID 66863334
benzyl N-[(3S)-4-amino-1-adamantyl]carbamate;hydrochloride (PubChem CID 66863334) has the molecular formula C18H25ClN2O2 and a molecular weight of 336.86 g/mol. Its IUPAC name is benzyl N-[(3S)-4-amino-1-adamantyl]carbamate;hydrochloride.
| Compound Name | benzyl N-[(3S)-4-amino-1-adamantyl]carbamate;hydrochloride |
|---|---|
| PubChem CID | 66863334 |
| Molecular Formula | C18H25ClN2O2 |
| Molecular Weight | 336.86 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | benzyl N-[(3S)-4-amino-1-adamantyl]carbamate;hydrochloride |
| SMILES | Cl.NC1C2CC3C[C@H]1CC(NC(=O)OCc1ccccc1)(C3)C2 |
| InChI | InChI=1S/C18H24N2O2.ClH/c19-16-14-6-13-7-15(16)10-18(8-13,9-14)20-17(21)22-11-12-4-2-1-3-5-12;/h1-5,13-16H,6-11,19H2,(H,20,21);1H/t13?,14-,15?,16?,18?;/m0./s1 |
| InChIKey | WUGWOYJMSTZTQT-DHHWQVGVSA-N |
| XLogP | 3.24 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.86 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |