C17H25ClN2O2 — CID 155387433
benzyl N-[4-(aminomethyl)-1-bicyclo[2.2.2]octanyl]carbamate;hydrochloride (PubChem CID 155387433) has the molecular formula C17H25ClN2O2 and a molecular weight of 324.85 g/mol. Its IUPAC name is benzyl N-[4-(aminomethyl)-1-bicyclo[2.2.2]octanyl]carbamate;hydrochloride.
| Compound Name | benzyl N-[4-(aminomethyl)-1-bicyclo[2.2.2]octanyl]carbamate;hydrochloride |
|---|---|
| PubChem CID | 155387433 |
| Molecular Formula | C17H25ClN2O2 |
| Molecular Weight | 324.85 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | benzyl N-[4-(aminomethyl)-1-bicyclo[2.2.2]octanyl]carbamate;hydrochloride |
| SMILES | Cl.NCC12CCC(NC(=O)OCc3ccccc3)(CC1)CC2 |
| InChI | InChI=1S/C17H24N2O2.ClH/c18-13-16-6-9-17(10-7-16,11-8-16)19-15(20)21-12-14-4-2-1-3-5-14;/h1-5H,6-13,18H2,(H,19,20);1H |
| InChIKey | WBSSKDSMVKCIOV-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.85 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |