C14H19ClN2O2 — CID 54595568
benzyl N-(4-amino-1-bicyclo[2.1.1]hexanyl)carbamate;hydrochloride (PubChem CID 54595568) has the molecular formula C14H19ClN2O2 and a molecular weight of 282.77 g/mol. Its IUPAC name is benzyl N-(4-amino-1-bicyclo[2.1.1]hexanyl)carbamate;hydrochloride.
| Compound Name | benzyl N-(4-amino-1-bicyclo[2.1.1]hexanyl)carbamate;hydrochloride |
|---|---|
| PubChem CID | 54595568 |
| Molecular Formula | C14H19ClN2O2 |
| Molecular Weight | 282.77 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | benzyl N-(4-amino-1-bicyclo[2.1.1]hexanyl)carbamate;hydrochloride |
| SMILES | Cl.NC12CCC(NC(=O)OCc3ccccc3)(C1)C2 |
| InChI | InChI=1S/C14H18N2O2.ClH/c15-13-6-7-14(9-13,10-13)16-12(17)18-8-11-4-2-1-3-5-11;/h1-5H,6-10,15H2,(H,16,17);1H |
| InChIKey | KDJXDQXODLIVKL-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.77 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |