C18H21F2NO2 — CID 101010410
benzyl N-[(3R,5S)-3,5-difluoro-1-adamantyl]carbamate (PubChem CID 101010410) has the molecular formula C18H21F2NO2 and a molecular weight of 321.37 g/mol. Its IUPAC name is benzyl N-[(3R,5S)-3,5-difluoro-1-adamantyl]carbamate.
| Compound Name | benzyl N-[(3R,5S)-3,5-difluoro-1-adamantyl]carbamate |
|---|---|
| PubChem CID | 101010410 |
| Molecular Formula | C18H21F2NO2 |
| Molecular Weight | 321.37 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | benzyl N-[(3R,5S)-3,5-difluoro-1-adamantyl]carbamate |
| SMILES | O=C(NC12CC3C[C@@](F)(C1)C[C@](F)(C3)C2)OCc1ccccc1 |
| InChI | InChI=1S/C18H21F2NO2/c19-16-6-14-7-17(20,10-16)12-18(8-14,11-16)21-15(22)23-9-13-4-2-1-3-5-13/h1-5,14H,6-12H2,(H,21,22)/t14?,16-,17+,18? |
| InChIKey | XPGKGZOVPKBFNJ-JGAFYBCUSA-N |
| XLogP | 4.07 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.37 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |