C22H24BrNO3 — CID 130431169
benzyl N-[(3S)-4-(4-bromophenyl)-3-hydroxy-1-bicyclo[2.2.2]octanyl]carbamate (PubChem CID 130431169) has the molecular formula C22H24BrNO3 and a molecular weight of 430.34 g/mol. Its IUPAC name is benzyl N-[(3S)-4-(4-bromophenyl)-3-hydroxy-1-bicyclo[2.2.2]octanyl]carbamate.
| Compound Name | benzyl N-[(3S)-4-(4-bromophenyl)-3-hydroxy-1-bicyclo[2.2.2]octanyl]carbamate |
|---|---|
| PubChem CID | 130431169 |
| Molecular Formula | C22H24BrNO3 |
| Molecular Weight | 430.34 g/mol |
| Exact Mass | 429.09 |
| IUPAC Name | benzyl N-[(3S)-4-(4-bromophenyl)-3-hydroxy-1-bicyclo[2.2.2]octanyl]carbamate |
| SMILES | O=C(NC12CCC(c3ccc(Br)cc3)(CC1)[C@@H](O)C2)OCc1ccccc1 |
| InChI | InChI=1S/C22H24BrNO3/c23-18-8-6-17(7-9-18)22-12-10-21(11-13-22,14-19(22)25)24-20(26)27-15-16-4-2-1-3-5-16/h1-9,19,25H,10-15H2,(H,24,26)/t19-,21?,22?/m0/s1 |
| InChIKey | CCFZJFCRTWIKMJ-KPQWGBOZSA-N |
| XLogP | 4.69 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.34 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |