C17H16FNO2 — CID 53216887
benzyl N-[1-(4-fluorophenyl)cyclopropyl]carbamate (PubChem CID 53216887) has the molecular formula C17H16FNO2 and a molecular weight of 285.32 g/mol. Its IUPAC name is benzyl N-[1-(4-fluorophenyl)cyclopropyl]carbamate.
| Compound Name | benzyl N-[1-(4-fluorophenyl)cyclopropyl]carbamate |
|---|---|
| PubChem CID | 53216887 |
| Molecular Formula | C17H16FNO2 |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | benzyl N-[1-(4-fluorophenyl)cyclopropyl]carbamate |
| SMILES | O=C(NC1(c2ccc(F)cc2)CC1)OCc1ccccc1 |
| InChI | InChI=1S/C17H16FNO2/c18-15-8-6-14(7-9-15)17(10-11-17)19-16(20)21-12-13-4-2-1-3-5-13/h1-9H,10-12H2,(H,19,20) |
| InChIKey | IGJYPXXIOMBUNS-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |