C19H19FO2 — CID 2381331
benzyl 1-(4-fluorophenyl)cyclopentane-1-carboxylate (PubChem CID 2381331) has the molecular formula C19H19FO2 and a molecular weight of 298.36 g/mol. Its IUPAC name is benzyl 1-(4-fluorophenyl)cyclopentane-1-carboxylate.
| Compound Name | benzyl 1-(4-fluorophenyl)cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 2381331 |
| Molecular Formula | C19H19FO2 |
| Molecular Weight | 298.36 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | benzyl 1-(4-fluorophenyl)cyclopentane-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)C1(c2ccc(F)cc2)CCCC1 |
| InChI | InChI=1S/C19H19FO2/c20-17-10-8-16(9-11-17)19(12-4-5-13-19)18(21)22-14-15-6-2-1-3-7-15/h1-3,6-11H,4-5,12-14H2 |
| InChIKey | MBFIGNASTVHIHZ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.36 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |