C22H20N2O6 — CID 101205282
dibenzyl (1R,4R)-3,6-dioxo-2,5-diazabicyclo[2.2.2]octane-1,4-dicarboxylate (PubChem CID 101205282) has the molecular formula C22H20N2O6 and a molecular weight of 408.41 g/mol. Its IUPAC name is dibenzyl (1R,4R)-3,6-dioxo-2,5-diazabicyclo[2.2.2]octane-1,4-dicarboxylate.
| Compound Name | dibenzyl (1R,4R)-3,6-dioxo-2,5-diazabicyclo[2.2.2]octane-1,4-dicarboxylate |
|---|---|
| PubChem CID | 101205282 |
| Molecular Formula | C22H20N2O6 |
| Molecular Weight | 408.41 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | dibenzyl (1R,4R)-3,6-dioxo-2,5-diazabicyclo[2.2.2]octane-1,4-dicarboxylate |
| SMILES | O=C1N[C@]2(C(=O)OCc3ccccc3)CC[C@@]1(C(=O)OCc1ccccc1)NC2=O |
| InChI | InChI=1S/C22H20N2O6/c25-17-21(19(27)29-13-15-7-3-1-4-8-15)11-12-22(24-17,18(26)23-21)20(28)30-14-16-9-5-2-6-10-16/h1-10H,11-14H2,(H,23,26)(H,24,25)/t21-,22-/m1/s1 |
| InChIKey | OMDRGXWZIVFICZ-FGZHOGPDSA-N |
| XLogP | 0.99 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.41 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|