C14H16O4 — CID 10824432
benzyl (1R)-1-hydroxy-3-oxocyclohexane-1-carboxylate (PubChem CID 10824432) has the molecular formula C14H16O4 and a molecular weight of 248.28 g/mol. Its IUPAC name is benzyl (1R)-1-hydroxy-3-oxocyclohexane-1-carboxylate.
| Compound Name | benzyl (1R)-1-hydroxy-3-oxocyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 10824432 |
| Molecular Formula | C14H16O4 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | benzyl (1R)-1-hydroxy-3-oxocyclohexane-1-carboxylate |
| SMILES | O=C1CCC[C@](O)(C(=O)OCc2ccccc2)C1 |
| InChI | InChI=1S/C14H16O4/c15-12-7-4-8-14(17,9-12)13(16)18-10-11-5-2-1-3-6-11/h1-3,5-6,17H,4,7-10H2/t14-/m1/s1 |
| InChIKey | DYJMYLSWBBWINQ-CQSZACIVSA-N |
| XLogP | 1.60 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |