C14H15IO4 — CID 102602708
1-O-benzyl 1-O'-(iodomethyl) cyclobutane-1,1-dicarboxylate (PubChem CID 102602708) has the molecular formula C14H15IO4 and a molecular weight of 374.17 g/mol. Its IUPAC name is 1-O-benzyl 1-O'-(iodomethyl) cyclobutane-1,1-dicarboxylate.
| Compound Name | 1-O-benzyl 1-O'-(iodomethyl) cyclobutane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 102602708 |
| Molecular Formula | C14H15IO4 |
| Molecular Weight | 374.17 g/mol |
| Exact Mass | 374.00 |
| IUPAC Name | 1-O-benzyl 1-O'-(iodomethyl) cyclobutane-1,1-dicarboxylate |
| SMILES | O=C(OCI)C1(C(=O)OCc2ccccc2)CCC1 |
| InChI | InChI=1S/C14H15IO4/c15-10-19-13(17)14(7-4-8-14)12(16)18-9-11-5-2-1-3-6-11/h1-3,5-6H,4,7-10H2 |
| InChIKey | LMMUZHDYYJGXMM-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.17 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|