C19H28O3 — CID 146647630
benzyl 2-ethoxy-1,3,3-trimethylcyclohexane-1-carboxylate (PubChem CID 146647630) has the molecular formula C19H28O3 and a molecular weight of 304.43 g/mol. Its IUPAC name is benzyl 2-ethoxy-1,3,3-trimethylcyclohexane-1-carboxylate.
| Compound Name | benzyl 2-ethoxy-1,3,3-trimethylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 146647630 |
| Molecular Formula | C19H28O3 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | benzyl 2-ethoxy-1,3,3-trimethylcyclohexane-1-carboxylate |
| SMILES | CCOC1C(C)(C)CCCC1(C)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C19H28O3/c1-5-21-16-18(2,3)12-9-13-19(16,4)17(20)22-14-15-10-7-6-8-11-15/h6-8,10-11,16H,5,9,12-14H2,1-4H3 |
| InChIKey | FTVFPULXSYXHTA-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |