C17H26O — CID 121352123
(2,2,6,6-tetramethylcyclohexyl)oxymethylbenzene (PubChem CID 121352123) has the molecular formula C17H26O and a molecular weight of 246.39 g/mol. Its IUPAC name is (2,2,6,6-tetramethylcyclohexyl)oxymethylbenzene.
| Compound Name | (2,2,6,6-tetramethylcyclohexyl)oxymethylbenzene |
|---|---|
| PubChem CID | 121352123 |
| Molecular Formula | C17H26O |
| Molecular Weight | 246.39 g/mol |
| Exact Mass | 246.20 |
| IUPAC Name | (2,2,6,6-tetramethylcyclohexyl)oxymethylbenzene |
| SMILES | CC1(C)CCCC(C)(C)C1OCc1ccccc1 |
| InChI | InChI=1S/C17H26O/c1-16(2)11-8-12-17(3,4)15(16)18-13-14-9-6-5-7-10-14/h5-7,9-10,15H,8,11-13H2,1-4H3 |
| InChIKey | XZAXXYFOOLZSPB-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.39 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |