C18H28O — CID 58078794
[(2R,5S)-2,3,4,5,6-pentamethylcyclohexyl]oxymethylbenzene (PubChem CID 58078794) has the molecular formula C18H28O and a molecular weight of 260.42 g/mol. Its IUPAC name is [(2R,5S)-2,3,4,5,6-pentamethylcyclohexyl]oxymethylbenzene.
| Compound Name | [(2R,5S)-2,3,4,5,6-pentamethylcyclohexyl]oxymethylbenzene |
|---|---|
| PubChem CID | 58078794 |
| Molecular Formula | C18H28O |
| Molecular Weight | 260.42 g/mol |
| Exact Mass | 260.21 |
| IUPAC Name | [(2R,5S)-2,3,4,5,6-pentamethylcyclohexyl]oxymethylbenzene |
| SMILES | CC1C(C)[C@@H](C)C(OCc2ccccc2)C(C)[C@H]1C |
| InChI | InChI=1S/C18H28O/c1-12-13(2)15(4)18(16(5)14(12)3)19-11-17-9-7-6-8-10-17/h6-10,12-16,18H,11H2,1-5H3/t12?,13-,14?,15?,16+,18?/m0/s1 |
| InChIKey | PSYIONLWPMHKOP-KEEQNQQHSA-N |
| XLogP | 4.77 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.42 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |