C16H22O3 — CID 10869085
(1R,2R,3S,4S,5R,6S)-2,4-dimethyl-3-phenylmethoxy-8-oxabicyclo[3.2.1]octan-6-ol (PubChem CID 10869085) has the molecular formula C16H22O3 and a molecular weight of 262.35 g/mol. Its IUPAC name is (1R,2R,3S,4S,5R,6S)-2,4-dimethyl-3-phenylmethoxy-8-oxabicyclo[3.2.1]octan-6-ol.
| Compound Name | (1R,2R,3S,4S,5R,6S)-2,4-dimethyl-3-phenylmethoxy-8-oxabicyclo[3.2.1]octan-6-ol |
|---|---|
| PubChem CID | 10869085 |
| Molecular Formula | C16H22O3 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | (1R,2R,3S,4S,5R,6S)-2,4-dimethyl-3-phenylmethoxy-8-oxabicyclo[3.2.1]octan-6-ol |
| SMILES | C[C@H]1[C@@H](OCc2ccccc2)[C@H](C)[C@H]2C[C@H](O)[C@@H]1O2 |
| InChI | InChI=1S/C16H22O3/c1-10-14-8-13(17)16(19-14)11(2)15(10)18-9-12-6-4-3-5-7-12/h3-7,10-11,13-17H,8-9H2,1-2H3/t10-,11+,13+,14-,15+,16-/m1/s1 |
| InChIKey | NGZCIIGSNOAORM-CDMIGPTGSA-N |
| XLogP | 2.38 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |