C14H16O6 — CID 101371356
(1S,5R,6S,8S)-9-phenylmethoxy-2,4,10-trioxatricyclo[3.3.1.13,7]decane-6,8-diol (PubChem CID 101371356) has the molecular formula C14H16O6 and a molecular weight of 280.28 g/mol. Its IUPAC name is (1S,5R,6S,8S)-9-phenylmethoxy-2,4,10-trioxatricyclo[3.3.1.13,7]decane-6,8-diol.
| Compound Name | (1S,5R,6S,8S)-9-phenylmethoxy-2,4,10-trioxatricyclo[3.3.1.13,7]decane-6,8-diol |
|---|---|
| PubChem CID | 101371356 |
| Molecular Formula | C14H16O6 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | (1S,5R,6S,8S)-9-phenylmethoxy-2,4,10-trioxatricyclo[3.3.1.13,7]decane-6,8-diol |
| SMILES | O[C@H]1C2OC3O[C@@H]1C(OCc1ccccc1)[C@H](O3)[C@H]2O |
| InChI | InChI=1S/C14H16O6/c15-8-10-9(16)12-13(11(8)19-14(18-10)20-12)17-6-7-4-2-1-3-5-7/h1-5,8-16H,6H2/t8-,9-,10?,11-,12+,13?,14?/m0/s1 |
| InChIKey | ZMBYIYSHPAMJOY-JYSGXIMLSA-N |
| XLogP | -0.23 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |