C21H22O8S — CID 101371360
[(1S,5S,6S,7R,8R,9R)-8-hydroxy-9-phenylmethoxy-2,4,10-trioxatricyclo[3.3.1.13,7]decan-6-yl] 4-methylbenzenesulfonate (PubChem CID 101371360) has the molecular formula C21H22O8S and a molecular weight of 434.47 g/mol. Its IUPAC name is [(1S,5S,6S,7R,8R,9R)-8-hydroxy-9-phenylmethoxy-2,4,10-trioxatricyclo[3.3.1.13,7]decan-6-yl] 4-methylbenzenesulfonate.
| Compound Name | [(1S,5S,6S,7R,8R,9R)-8-hydroxy-9-phenylmethoxy-2,4,10-trioxatricyclo[3.3.1.13,7]decan-6-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 101371360 |
| Molecular Formula | C21H22O8S |
| Molecular Weight | 434.47 g/mol |
| Exact Mass | 434.10 |
| IUPAC Name | [(1S,5S,6S,7R,8R,9R)-8-hydroxy-9-phenylmethoxy-2,4,10-trioxatricyclo[3.3.1.13,7]decan-6-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O[C@@H]2[C@H]3OC4O[C@@H]2[C@H](O)[C@H](O4)[C@H]3OCc2ccccc2)cc1 |
| InChI | InChI=1S/C21H22O8S/c1-12-7-9-14(10-8-12)30(23,24)29-20-17-15(22)16-18(19(20)28-21(26-16)27-17)25-11-13-5-3-2-4-6-13/h2-10,15-22H,11H2,1H3/t15-,16+,17-,18-,19+,20+,21?/m1/s1 |
| InChIKey | KXNMQSNQSQYFGC-VLEJQQDSSA-N |
| XLogP | 1.50 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.47 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|