C21H22O10S2 — CID 102511250
[(1R,6R,7S,9R)-8-hydroxy-9-(4-methylphenyl)sulfonyloxy-2,4,10-trioxatricyclo[3.3.1.13,7]decan-6-yl] 4-methylbenzenesulfonate (PubChem CID 102511250) has the molecular formula C21H22O10S2 and a molecular weight of 498.53 g/mol. Its IUPAC name is [(1R,6R,7S,9R)-8-hydroxy-9-(4-methylphenyl)sulfonyloxy-2,4,10-trioxatricyclo[3.3.1.13,7]decan-6-yl] 4-methylbenzenesulfonate.
| Compound Name | [(1R,6R,7S,9R)-8-hydroxy-9-(4-methylphenyl)sulfonyloxy-2,4,10-trioxatricyclo[3.3.1.13,7]decan-6-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 102511250 |
| Molecular Formula | C21H22O10S2 |
| Molecular Weight | 498.53 g/mol |
| Exact Mass | 498.07 |
| IUPAC Name | [(1R,6R,7S,9R)-8-hydroxy-9-(4-methylphenyl)sulfonyloxy-2,4,10-trioxatricyclo[3.3.1.13,7]decan-6-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O[C@H]2C3OC4O[C@@H]2C(O)[C@H](O4)[C@H]3OS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C21H22O10S2/c1-11-3-7-13(8-4-11)32(23,24)30-19-16-15(22)17-20(18(19)29-21(27-16)28-17)31-33(25,26)14-9-5-12(2)6-10-14/h3-10,15-22H,1-2H3/t15?,16-,17+,18?,19-,20-,21?/m1/s1 |
| InChIKey | TWYVISVHWNRKMU-YMQWCOLISA-N |
| XLogP | 0.99 |
| TPSA | 134.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.53 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|