C14H20O7S — CID 58419244
[(3R,4S,5S,6R)-6-ethyl-2,4,5-trihydroxyoxan-3-yl] 4-methylbenzenesulfonate (PubChem CID 58419244) has the molecular formula C14H20O7S and a molecular weight of 332.37 g/mol. Its IUPAC name is [(3R,4S,5S,6R)-6-ethyl-2,4,5-trihydroxyoxan-3-yl] 4-methylbenzenesulfonate.
| Compound Name | [(3R,4S,5S,6R)-6-ethyl-2,4,5-trihydroxyoxan-3-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 58419244 |
| Molecular Formula | C14H20O7S |
| Molecular Weight | 332.37 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | [(3R,4S,5S,6R)-6-ethyl-2,4,5-trihydroxyoxan-3-yl] 4-methylbenzenesulfonate |
| SMILES | CC[C@H]1OC(O)[C@H](OS(=O)(=O)c2ccc(C)cc2)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C14H20O7S/c1-3-10-11(15)12(16)13(14(17)20-10)21-22(18,19)9-6-4-8(2)5-7-9/h4-7,10-17H,3H2,1-2H3/t10-,11-,12+,13-,14?/m1/s1 |
| InChIKey | PDQPXUVUKFAKKW-RQICVUQASA-N |
| XLogP | -0.08 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.37 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|