C13H19NO7S — CID 171126888
[(2S,3S,4R,5S,6R)-5-amino-3,4,6-trihydroxyoxan-2-yl]methyl 4-methylbenzenesulfonate (PubChem CID 171126888) has the molecular formula C13H19NO7S and a molecular weight of 333.36 g/mol. Its IUPAC name is [(2S,3S,4R,5S,6R)-5-amino-3,4,6-trihydroxyoxan-2-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(2S,3S,4R,5S,6R)-5-amino-3,4,6-trihydroxyoxan-2-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 171126888 |
| Molecular Formula | C13H19NO7S |
| Molecular Weight | 333.36 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | [(2S,3S,4R,5S,6R)-5-amino-3,4,6-trihydroxyoxan-2-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@@H]2O[C@@H](O)[C@@H](N)[C@@H](O)[C@@H]2O)cc1 |
| InChI | InChI=1S/C13H19NO7S/c1-7-2-4-8(5-3-7)22(18,19)20-6-9-11(15)12(16)10(14)13(17)21-9/h2-5,9-13,15-17H,6,14H2,1H3/t9-,10-,11+,12+,13+/m0/s1 |
| InChIKey | JZZOHMGMVYYHGL-KIJLLGNVSA-N |
| XLogP | -1.53 |
| TPSA | 139.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.36 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|