C18H29NO11S — CID 91390690
[(3R,4R)-5-amino-3,4,6-trihydroxyoxan-2-yl]methyl 4-methylbenzenesulfonate;2-(2-methoxyethoxy)acetic acid (PubChem CID 91390690) has the molecular formula C18H29NO11S and a molecular weight of 467.49 g/mol. Its IUPAC name is [(3R,4R)-5-amino-3,4,6-trihydroxyoxan-2-yl]methyl 4-methylbenzenesulfonate;2-(2-methoxyethoxy)acetic acid.
| Compound Name | [(3R,4R)-5-amino-3,4,6-trihydroxyoxan-2-yl]methyl 4-methylbenzenesulfonate;2-(2-methoxyethoxy)acetic acid |
|---|---|
| PubChem CID | 91390690 |
| Molecular Formula | C18H29NO11S |
| Molecular Weight | 467.49 g/mol |
| Exact Mass | 467.15 |
| IUPAC Name | [(3R,4R)-5-amino-3,4,6-trihydroxyoxan-2-yl]methyl 4-methylbenzenesulfonate;2-(2-methoxyethoxy)acetic acid |
| SMILES | COCCOCC(=O)O.Cc1ccc(S(=O)(=O)OCC2OC(O)C(N)[C@@H](O)[C@H]2O)cc1 |
| InChI | InChI=1S/C13H19NO7S.C5H10O4/c1-7-2-4-8(5-3-7)22(18,19)20-6-9-11(15)12(16)10(14)13(17)21-9;1-8-2-3-9-4-5(6)7/h2-5,9-13,15-17H,6,14H2,1H3;2-4H2,1H3,(H,6,7)/t9?,10?,11-,12+,13?;/m0./s1 |
| InChIKey | QPMRCSIIAPAMGJ-HLECEYTKSA-N |
| XLogP | -1.80 |
| TPSA | 195.07 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.49 |
| LogP ≤ 5 | -1.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|