C21H25NO9S — CID 171122150
[(2R,3S,4R,5S,6S)-3,4,6-trihydroxy-5-(phenylmethoxycarbonylamino)oxan-2-yl]methyl 4-methylbenzenesulfonate (PubChem CID 171122150) has the molecular formula C21H25NO9S and a molecular weight of 467.50 g/mol. Its IUPAC name is [(2R,3S,4R,5S,6S)-3,4,6-trihydroxy-5-(phenylmethoxycarbonylamino)oxan-2-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(2R,3S,4R,5S,6S)-3,4,6-trihydroxy-5-(phenylmethoxycarbonylamino)oxan-2-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 171122150 |
| Molecular Formula | C21H25NO9S |
| Molecular Weight | 467.50 g/mol |
| Exact Mass | 467.13 |
| IUPAC Name | [(2R,3S,4R,5S,6S)-3,4,6-trihydroxy-5-(phenylmethoxycarbonylamino)oxan-2-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@H]2O[C@H](O)[C@@H](NC(=O)OCc3ccccc3)[C@@H](O)[C@@H]2O)cc1 |
| InChI | InChI=1S/C21H25NO9S/c1-13-7-9-15(10-8-13)32(27,28)30-12-16-18(23)19(24)17(20(25)31-16)22-21(26)29-11-14-5-3-2-4-6-14/h2-10,16-20,23-25H,11-12H2,1H3,(H,22,26)/t16-,17+,18-,19-,20+/m1/s1 |
| InChIKey | XNQNJGXWIAKDPE-IVDHNXQLSA-N |
| XLogP | 0.43 |
| TPSA | 151.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.50 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|