C15H21NO8S — CID 23259725
[(2R,3S,4R,5R,6R)-5-acetamido-3,4,6-trihydroxyoxan-2-yl]methyl 4-methylbenzenesulfonate (PubChem CID 23259725) has the molecular formula C15H21NO8S and a molecular weight of 375.40 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6R)-5-acetamido-3,4,6-trihydroxyoxan-2-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(2R,3S,4R,5R,6R)-5-acetamido-3,4,6-trihydroxyoxan-2-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 23259725 |
| Molecular Formula | C15H21NO8S |
| Molecular Weight | 375.40 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | [(2R,3S,4R,5R,6R)-5-acetamido-3,4,6-trihydroxyoxan-2-yl]methyl 4-methylbenzenesulfonate |
| SMILES | CC(=O)N[C@@H]1[C@@H](O)[C@H](O)[C@@H](COS(=O)(=O)c2ccc(C)cc2)O[C@H]1O |
| InChI | InChI=1S/C15H21NO8S/c1-8-3-5-10(6-4-8)25(21,22)23-7-11-13(18)14(19)12(15(20)24-11)16-9(2)17/h3-6,11-15,18-20H,7H2,1-2H3,(H,16,17)/t11-,12-,13-,14-,15-/m1/s1 |
| InChIKey | MYOJZLVNVQJDRS-KJWHEZOQSA-N |
| XLogP | -1.36 |
| TPSA | 142.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.40 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|