C18H27NO9S — CID 139683325
[(2R,3S,4R,5R)-3,4,6-trihydroxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]oxan-2-yl]methyl 4-methylbenzenesulfonate (PubChem CID 139683325) has the molecular formula C18H27NO9S and a molecular weight of 433.48 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-3,4,6-trihydroxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]oxan-2-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(2R,3S,4R,5R)-3,4,6-trihydroxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]oxan-2-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 139683325 |
| Molecular Formula | C18H27NO9S |
| Molecular Weight | 433.48 g/mol |
| Exact Mass | 433.14 |
| IUPAC Name | [(2R,3S,4R,5R)-3,4,6-trihydroxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]oxan-2-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@H]2OC(O)[C@H](NC(=O)OC(C)(C)C)[C@@H](O)[C@@H]2O)cc1 |
| InChI | InChI=1S/C18H27NO9S/c1-10-5-7-11(8-6-10)29(24,25)26-9-12-14(20)15(21)13(16(22)27-12)19-17(23)28-18(2,3)4/h5-8,12-16,20-22H,9H2,1-4H3,(H,19,23)/t12-,13-,14-,15-,16?/m1/s1 |
| InChIKey | BHVBVXWFLBOEGP-XIHUBIEQSA-N |
| XLogP | 0.03 |
| TPSA | 151.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.48 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|