C18H25NO8S — CID 10949737
[(2R,3S,4R,5R)-5-acetamido-3,4-dihydroxy-6-prop-2-enoxyoxan-2-yl]methyl 4-methylbenzenesulfonate (PubChem CID 10949737) has the molecular formula C18H25NO8S and a molecular weight of 415.46 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-acetamido-3,4-dihydroxy-6-prop-2-enoxyoxan-2-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(2R,3S,4R,5R)-5-acetamido-3,4-dihydroxy-6-prop-2-enoxyoxan-2-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 10949737 |
| Molecular Formula | C18H25NO8S |
| Molecular Weight | 415.46 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | [(2R,3S,4R,5R)-5-acetamido-3,4-dihydroxy-6-prop-2-enoxyoxan-2-yl]methyl 4-methylbenzenesulfonate |
| SMILES | C=CCOC1O[C@H](COS(=O)(=O)c2ccc(C)cc2)[C@@H](O)[C@H](O)[C@H]1NC(C)=O |
| InChI | InChI=1S/C18H25NO8S/c1-4-9-25-18-15(19-12(3)20)17(22)16(21)14(27-18)10-26-28(23,24)13-7-5-11(2)6-8-13/h4-8,14-18,21-22H,1,9-10H2,2-3H3,(H,19,20)/t14-,15-,16-,17-,18?/m1/s1 |
| InChIKey | YHHUWVNGSJOGES-XNIMBYMISA-N |
| XLogP | -0.15 |
| TPSA | 131.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.46 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|