C12H16O7S — CID 23207115
(3,4,5-trihydroxyoxolan-2-yl)methyl 4-methylbenzenesulfonate (PubChem CID 23207115) has the molecular formula C12H16O7S and a molecular weight of 304.32 g/mol. Its IUPAC name is (3,4,5-trihydroxyoxolan-2-yl)methyl 4-methylbenzenesulfonate.
| Compound Name | (3,4,5-trihydroxyoxolan-2-yl)methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 23207115 |
| Molecular Formula | C12H16O7S |
| Molecular Weight | 304.32 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | (3,4,5-trihydroxyoxolan-2-yl)methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC2OC(O)C(O)C2O)cc1 |
| InChI | InChI=1S/C12H16O7S/c1-7-2-4-8(5-3-7)20(16,17)18-6-9-10(13)11(14)12(15)19-9/h2-5,9-15H,6H2,1H3 |
| InChIKey | NAVDSAKQFWCIEI-UHFFFAOYSA-N |
| XLogP | -0.86 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.32 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|