C14H20O7S2 — CID 117066252
(3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl)methyl 4-methylbenzenesulfonate (PubChem CID 117066252) has the molecular formula C14H20O7S2 and a molecular weight of 364.44 g/mol. Its IUPAC name is (3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl)methyl 4-methylbenzenesulfonate.
| Compound Name | (3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl)methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 117066252 |
| Molecular Formula | C14H20O7S2 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | (3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl)methyl 4-methylbenzenesulfonate |
| SMILES | CSC1OC(COS(=O)(=O)c2ccc(C)cc2)C(O)C(O)C1O |
| InChI | InChI=1S/C14H20O7S2/c1-8-3-5-9(6-4-8)23(18,19)20-7-10-11(15)12(16)13(17)14(21-10)22-2/h3-6,10-17H,7H2,1-2H3 |
| InChIKey | ABKCHNPPEMEVRB-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|