C19H24O11S — CID 171122552
[(2S,3R,4S,5R,6S)-4,5-diacetyloxy-6-hydroxy-2-[(4-methylphenyl)sulfonyloxymethyl]oxan-3-yl] acetate (PubChem CID 171122552) has the molecular formula C19H24O11S and a molecular weight of 460.46 g/mol. Its IUPAC name is [(2S,3R,4S,5R,6S)-4,5-diacetyloxy-6-hydroxy-2-[(4-methylphenyl)sulfonyloxymethyl]oxan-3-yl] acetate.
| Compound Name | [(2S,3R,4S,5R,6S)-4,5-diacetyloxy-6-hydroxy-2-[(4-methylphenyl)sulfonyloxymethyl]oxan-3-yl] acetate |
|---|---|
| PubChem CID | 171122552 |
| Molecular Formula | C19H24O11S |
| Molecular Weight | 460.46 g/mol |
| Exact Mass | 460.10 |
| IUPAC Name | [(2S,3R,4S,5R,6S)-4,5-diacetyloxy-6-hydroxy-2-[(4-methylphenyl)sulfonyloxymethyl]oxan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H](OC(C)=O)[C@@H](O)O[C@@H](COS(=O)(=O)c2ccc(C)cc2)[C@H]1OC(C)=O |
| InChI | InChI=1S/C19H24O11S/c1-10-5-7-14(8-6-10)31(24,25)26-9-15-16(27-11(2)20)17(28-12(3)21)18(19(23)30-15)29-13(4)22/h5-8,15-19,23H,9H2,1-4H3/t15-,16+,17-,18+,19-/m0/s1 |
| InChIKey | OQZKYGWJKYFJMU-APAFKAMOSA-N |
| XLogP | 0.21 |
| TPSA | 151.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.46 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|