C20H26O11S — CID 45050214
[(3R,4S,5R)-4,5-diacetyloxy-6-methoxy-2-[(4-methylphenyl)sulfonyloxymethyl]oxan-3-yl] acetate (PubChem CID 45050214) has the molecular formula C20H26O11S and a molecular weight of 474.48 g/mol. Its IUPAC name is [(3R,4S,5R)-4,5-diacetyloxy-6-methoxy-2-[(4-methylphenyl)sulfonyloxymethyl]oxan-3-yl] acetate.
| Compound Name | [(3R,4S,5R)-4,5-diacetyloxy-6-methoxy-2-[(4-methylphenyl)sulfonyloxymethyl]oxan-3-yl] acetate |
|---|---|
| PubChem CID | 45050214 |
| Molecular Formula | C20H26O11S |
| Molecular Weight | 474.48 g/mol |
| Exact Mass | 474.12 |
| IUPAC Name | [(3R,4S,5R)-4,5-diacetyloxy-6-methoxy-2-[(4-methylphenyl)sulfonyloxymethyl]oxan-3-yl] acetate |
| SMILES | COC1OC(COS(=O)(=O)c2ccc(C)cc2)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C20H26O11S/c1-11-6-8-15(9-7-11)32(24,25)27-10-16-17(28-12(2)21)18(29-13(3)22)19(30-14(4)23)20(26-5)31-16/h6-9,16-20H,10H2,1-5H3/t16?,17-,18+,19-,20?/m1/s1 |
| InChIKey | DYNSMQWMUMIXJH-FNNTYFIOSA-N |
| XLogP | 0.87 |
| TPSA | 140.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.48 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|