C35H34O14S2 — CID 99727703
[(2R,3R,4S,5S,6R)-6-methoxy-3-(4-methylphenyl)sulfonyloxy-4,5-bis(phenoxycarbonyloxy)oxan-2-yl]methyl 4-methylbenzenesulfonate (PubChem CID 99727703) has the molecular formula C35H34O14S2 and a molecular weight of 742.78 g/mol. Its IUPAC name is [(2R,3R,4S,5S,6R)-6-methoxy-3-(4-methylphenyl)sulfonyloxy-4,5-bis(phenoxycarbonyloxy)oxan-2-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(2R,3R,4S,5S,6R)-6-methoxy-3-(4-methylphenyl)sulfonyloxy-4,5-bis(phenoxycarbonyloxy)oxan-2-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 99727703 |
| Molecular Formula | C35H34O14S2 |
| Molecular Weight | 742.78 g/mol |
| Exact Mass | 742.14 |
| IUPAC Name | [(2R,3R,4S,5S,6R)-6-methoxy-3-(4-methylphenyl)sulfonyloxy-4,5-bis(phenoxycarbonyloxy)oxan-2-yl]methyl 4-methylbenzenesulfonate |
| SMILES | CO[C@@H]1O[C@H](COS(=O)(=O)c2ccc(C)cc2)[C@@H](OS(=O)(=O)c2ccc(C)cc2)[C@@H](OC(=O)Oc2ccccc2)[C@@H]1OC(=O)Oc1ccccc1 |
| InChI | InChI=1S/C35H34O14S2/c1-23-14-18-27(19-15-23)50(38,39)43-22-29-30(49-51(40,41)28-20-16-24(2)17-21-28)31(47-34(36)44-25-10-6-4-7-11-25)32(33(42-3)46-29)48-35(37)45-26-12-8-5-9-13-26/h4-21,29-33H,22H2,1-3H3/t29-,30-,31-,32+,33-/m1/s1 |
| InChIKey | XOHVXTSZCPGRLC-LGXXXXLNSA-N |
| XLogP | 5.32 |
| TPSA | 176.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.78 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|