C23H30O10S2 — CID 54131403
[(2S,3R,4S,5R,6R)-2,5-dimethoxy-6-(methoxymethyl)-3-(4-methylphenyl)sulfonyloxyoxan-4-yl] 4-methylbenzenesulfonate (PubChem CID 54131403) has the molecular formula C23H30O10S2 and a molecular weight of 530.62 g/mol. Its IUPAC name is [(2S,3R,4S,5R,6R)-2,5-dimethoxy-6-(methoxymethyl)-3-(4-methylphenyl)sulfonyloxyoxan-4-yl] 4-methylbenzenesulfonate.
| Compound Name | [(2S,3R,4S,5R,6R)-2,5-dimethoxy-6-(methoxymethyl)-3-(4-methylphenyl)sulfonyloxyoxan-4-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 54131403 |
| Molecular Formula | C23H30O10S2 |
| Molecular Weight | 530.62 g/mol |
| Exact Mass | 530.13 |
| IUPAC Name | [(2S,3R,4S,5R,6R)-2,5-dimethoxy-6-(methoxymethyl)-3-(4-methylphenyl)sulfonyloxyoxan-4-yl] 4-methylbenzenesulfonate |
| SMILES | COC[C@H]1O[C@H](OC)[C@H](OS(=O)(=O)c2ccc(C)cc2)[C@@H](OS(=O)(=O)c2ccc(C)cc2)[C@@H]1OC |
| InChI | InChI=1S/C23H30O10S2/c1-15-6-10-17(11-7-15)34(24,25)32-21-20(29-4)19(14-28-3)31-23(30-5)22(21)33-35(26,27)18-12-8-16(2)9-13-18/h6-13,19-23H,14H2,1-5H3/t19-,20-,21+,22-,23+/m1/s1 |
| InChIKey | NUQBNLOGTOZXIL-ZQGJOIPISA-N |
| XLogP | 2.18 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.62 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|