C16H20O9S — CID 171125253
[(2R,3S,4R)-4-acetyloxy-5-hydroxy-3-(4-methylphenyl)sulfonyloxyoxolan-2-yl]methyl acetate (PubChem CID 171125253) has the molecular formula C16H20O9S and a molecular weight of 388.39 g/mol. Its IUPAC name is [(2R,3S,4R)-4-acetyloxy-5-hydroxy-3-(4-methylphenyl)sulfonyloxyoxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R)-4-acetyloxy-5-hydroxy-3-(4-methylphenyl)sulfonyloxyoxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 171125253 |
| Molecular Formula | C16H20O9S |
| Molecular Weight | 388.39 g/mol |
| Exact Mass | 388.08 |
| IUPAC Name | [(2R,3S,4R)-4-acetyloxy-5-hydroxy-3-(4-methylphenyl)sulfonyloxyoxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1OC(O)[C@H](OC(C)=O)[C@H]1OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C16H20O9S/c1-9-4-6-12(7-5-9)26(20,21)25-14-13(8-22-10(2)17)24-16(19)15(14)23-11(3)18/h4-7,13-16,19H,8H2,1-3H3/t13-,14+,15-,16?/m1/s1 |
| InChIKey | PUULUKRKSFCKBL-IUOOZAAYSA-N |
| XLogP | 0.28 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.39 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|