C20H21ClN2O10S — CID 87408934
[(2R,3S,4R,5R)-4-acetyloxy-5-(5-chloro-2,4-dioxopyrimidin-1-yl)-3-(4-methylphenyl)sulfonyloxyoxolan-2-yl]methyl acetate (PubChem CID 87408934) has the molecular formula C20H21ClN2O10S and a molecular weight of 516.91 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-4-acetyloxy-5-(5-chloro-2,4-dioxopyrimidin-1-yl)-3-(4-methylphenyl)sulfonyloxyoxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R)-4-acetyloxy-5-(5-chloro-2,4-dioxopyrimidin-1-yl)-3-(4-methylphenyl)sulfonyloxyoxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 87408934 |
| Molecular Formula | C20H21ClN2O10S |
| Molecular Weight | 516.91 g/mol |
| Exact Mass | 516.06 |
| IUPAC Name | [(2R,3S,4R,5R)-4-acetyloxy-5-(5-chloro-2,4-dioxopyrimidin-1-yl)-3-(4-methylphenyl)sulfonyloxyoxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](n2cc(Cl)c(=O)[nH]c2=O)[C@H](OC(C)=O)[C@H]1OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C20H21ClN2O10S/c1-10-4-6-13(7-5-10)34(28,29)33-16-15(9-30-11(2)24)32-19(17(16)31-12(3)25)23-8-14(21)18(26)22-20(23)27/h4-8,15-17,19H,9H2,1-3H3,(H,22,26,27)/t15-,16+,17-,19-/m1/s1 |
| InChIKey | LQGBIHCBFGFMLZ-SFNKJDCFSA-N |
| XLogP | 0.66 |
| TPSA | 160.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.91 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|