C15H20N2O10S — CID 87409529
[(2R,3S,4R,5R)-4-acetyloxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-3-methylsulfonyloxyoxolan-2-yl]methyl acetate (PubChem CID 87409529) has the molecular formula C15H20N2O10S and a molecular weight of 420.40 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-4-acetyloxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-3-methylsulfonyloxyoxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R)-4-acetyloxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-3-methylsulfonyloxyoxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 87409529 |
| Molecular Formula | C15H20N2O10S |
| Molecular Weight | 420.40 g/mol |
| Exact Mass | 420.08 |
| IUPAC Name | [(2R,3S,4R,5R)-4-acetyloxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-3-methylsulfonyloxyoxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](n2cc(C)c(=O)[nH]c2=O)[C@H](OC(C)=O)[C@H]1OS(C)(=O)=O |
| InChI | InChI=1S/C15H20N2O10S/c1-7-5-17(15(21)16-13(7)20)14-12(25-9(3)19)11(27-28(4,22)23)10(26-14)6-24-8(2)18/h5,10-12,14H,6H2,1-4H3,(H,16,20,21)/t10-,11+,12-,14-/m1/s1 |
| InChIKey | FHDCKDMZAQNLMR-GFQSEFKGSA-N |
| XLogP | -1.42 |
| TPSA | 160.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.40 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|