C14H17N5O7 — CID 171361605
[(2R,3S,4R,5R)-3-acetyloxy-4-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl acetate (PubChem CID 171361605) has the molecular formula C14H17N5O7 and a molecular weight of 367.32 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-3-acetyloxy-4-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R)-3-acetyloxy-4-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 171361605 |
| Molecular Formula | C14H17N5O7 |
| Molecular Weight | 367.32 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | [(2R,3S,4R,5R)-3-acetyloxy-4-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](n2cc(C)c(=O)[nH]c2=O)[C@H](N=[N+]=[N-])[C@@H]1OC(C)=O |
| InChI | InChI=1S/C14H17N5O7/c1-6-4-19(14(23)16-12(6)22)13-10(17-18-15)11(25-8(3)21)9(26-13)5-24-7(2)20/h4,9-11,13H,5H2,1-3H3,(H,16,22,23)/t9-,10-,11-,13-/m1/s1 |
| InChIKey | LMZWIWZJIZWHIW-PRULPYPASA-N |
| XLogP | -0.08 |
| TPSA | 165.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.32 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|