C16H20N2O8S — CID 22792087
[(2R,3R,4R,5R)-3,4-diacetyloxy-5-(5-methyl-4-oxo-2-sulfanylidenepyrimidin-1-yl)oxolan-2-yl]methyl acetate (PubChem CID 22792087) has the molecular formula C16H20N2O8S and a molecular weight of 400.41 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-3,4-diacetyloxy-5-(5-methyl-4-oxo-2-sulfanylidenepyrimidin-1-yl)oxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5R)-3,4-diacetyloxy-5-(5-methyl-4-oxo-2-sulfanylidenepyrimidin-1-yl)oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 22792087 |
| Molecular Formula | C16H20N2O8S |
| Molecular Weight | 400.41 g/mol |
| Exact Mass | 400.09 |
| IUPAC Name | [(2R,3R,4R,5R)-3,4-diacetyloxy-5-(5-methyl-4-oxo-2-sulfanylidenepyrimidin-1-yl)oxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](n2cc(C)c(=O)[nH]c2=S)[C@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C16H20N2O8S/c1-7-5-18(16(27)17-14(7)22)15-13(25-10(4)21)12(24-9(3)20)11(26-15)6-23-8(2)19/h5,11-13,15H,6H2,1-4H3,(H,17,22,27)/t11-,12-,13-,15-/m1/s1 |
| InChIKey | GLCCZIHBMBWIRV-RGCMKSIDSA-N |
| XLogP | 0.54 |
| TPSA | 125.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.41 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|