C19H24N2O11 — CID 122597251
[(3S,5S,6R)-3,4,5-triacetyloxy-6-(5-methyl-2,4-dioxopyrimidin-1-yl)oxan-2-yl]methyl acetate (PubChem CID 122597251) has the molecular formula C19H24N2O11 and a molecular weight of 456.40 g/mol. Its IUPAC name is [(3S,5S,6R)-3,4,5-triacetyloxy-6-(5-methyl-2,4-dioxopyrimidin-1-yl)oxan-2-yl]methyl acetate.
| Compound Name | [(3S,5S,6R)-3,4,5-triacetyloxy-6-(5-methyl-2,4-dioxopyrimidin-1-yl)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 122597251 |
| Molecular Formula | C19H24N2O11 |
| Molecular Weight | 456.40 g/mol |
| Exact Mass | 456.14 |
| IUPAC Name | [(3S,5S,6R)-3,4,5-triacetyloxy-6-(5-methyl-2,4-dioxopyrimidin-1-yl)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1O[C@@H](n2cc(C)c(=O)[nH]c2=O)[C@@H](OC(C)=O)C(OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C19H24N2O11/c1-8-6-21(19(27)20-17(8)26)18-16(31-12(5)25)15(30-11(4)24)14(29-10(3)23)13(32-18)7-28-9(2)22/h6,13-16,18H,7H2,1-5H3,(H,20,26,27)/t13?,14-,15?,16-,18+/m0/s1 |
| InChIKey | AFDRLILJDIBGJO-CLVQRLLRSA-N |
| XLogP | -0.90 |
| TPSA | 169.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.40 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|