C17H23N2O12P — CID 102441747
[(2R,3R,4R,5R)-3,4-diacetyloxy-5-(5-dimethoxyphosphoryl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl acetate (PubChem CID 102441747) has the molecular formula C17H23N2O12P and a molecular weight of 478.35 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-3,4-diacetyloxy-5-(5-dimethoxyphosphoryl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5R)-3,4-diacetyloxy-5-(5-dimethoxyphosphoryl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 102441747 |
| Molecular Formula | C17H23N2O12P |
| Molecular Weight | 478.35 g/mol |
| Exact Mass | 478.10 |
| IUPAC Name | [(2R,3R,4R,5R)-3,4-diacetyloxy-5-(5-dimethoxyphosphoryl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl acetate |
| SMILES | COP(=O)(OC)c1cn([C@@H]2O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H]2OC(C)=O)c(=O)[nH]c1=O |
| InChI | InChI=1S/C17H23N2O12P/c1-8(20)28-7-11-13(29-9(2)21)14(30-10(3)22)16(31-11)19-6-12(15(23)18-17(19)24)32(25,26-4)27-5/h6,11,13-14,16H,7H2,1-5H3,(H,18,23,24)/t11-,13-,14-,16-/m1/s1 |
| InChIKey | OVCCESRSUCWKFX-XKVFNRALSA-N |
| XLogP | -1.03 |
| TPSA | 178.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.35 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|